9074-07-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H15Cl2N3.
The synonyms of the compound include 90747-46-9, 4-(1H-Imidazol-2-yl)piperidine dihydrochloride, and MFCD08669023.
The molecular weight of the compound is 224.13 g/mol.
The component compounds include CID 13281190 (4-(1H-imidazol-2-yl)piperidine) and CID 313 (Hydrochloric Acid).
The IUPAC name of the compound is 4-(1H-imidazol-2-yl)piperidine;dihydrochloride.
The InChI of the compound is InChI=1S/C8H13N3.2ClH/c1-3-9-4-2-7(1)8-10-5-6-11-8;;/h5-7,9H,1-4H2,(H,10,11);2*1H.
The InChIKey of the compound is VCDBJWFWCOSTMS-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1CNCCC1C2=NC=CN2.Cl.Cl.
The hydrogen bond donor count of the compound is 4.
Yes, the compound is Canonicalized.