CAS
907162-33-8 Purity
---
907162-33-8 Purity
---
Inquiry Basket
6-Bromo-2-pyridineacetic acid methyl ester
CAS
907191-65-5
Catalog Number
ACM907191655
Category
Other Products
Molecular Formula
C8H8BrNO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 6-Bromo-2-pyridineacetic acid methyl ester?
The molecular formula of 6-Bromo-2-pyridineacetic acid methyl ester is C8H8BrNO2.
What are the synonyms for 6-Bromo-2-pyridineacetic acid methyl ester?
The synonyms for 6-Bromo-2-pyridineacetic acid methyl ester are Methyl 2-(6-bromopyridin-2-yl)acetate, 907191-65-5, methyl (6-bromo-2-pyridinyl)acetate, and methyl (6-bromopyridin-2-yl)acetate.
What is the molecular weight of 6-Bromo-2-pyridineacetic acid methyl ester?
The molecular weight of 6-Bromo-2-pyridineacetic acid methyl ester is 230.06 g/mol.
What is the IUPAC name of 6-Bromo-2-pyridineacetic acid methyl ester?
The IUPAC name of 6-Bromo-2-pyridineacetic acid methyl ester is methyl 2-(6-bromopyridin-2-yl)acetate.
What is the InChI of 6-Bromo-2-pyridineacetic acid methyl ester?
The InChI of 6-Bromo-2-pyridineacetic acid methyl ester is InChI=1S/C8H8BrNO2/c1-12-8(11)5-6-3-2-4-7(9)10-6/h2-4H,5H2,1H3.
What is the InChIKey of 6-Bromo-2-pyridineacetic acid methyl ester?
The InChIKey of 6-Bromo-2-pyridineacetic acid methyl ester is KSTQSTLAWKUGMF-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromo-2-pyridineacetic acid methyl ester?
The canonical SMILES of 6-Bromo-2-pyridineacetic acid methyl ester is COC(=O)CC1=NC(=CC=C1)Br.
What is the XLogP3-AA value of 6-Bromo-2-pyridineacetic acid methyl ester?
The XLogP3-AA value of 6-Bromo-2-pyridineacetic acid methyl ester is 1.7.
How many hydrogen bond donor counts does 6-Bromo-2-pyridineacetic acid methyl ester have?
6-Bromo-2-pyridineacetic acid methyl ester has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 6-Bromo-2-pyridineacetic acid methyl ester have?
6-Bromo-2-pyridineacetic acid methyl ester has 3 hydrogen bond acceptor counts.
Recommended Products
![2-Oxazolidinone,4-(1-methylethyl)-3-[(2E)-1-oxo-2-buten-1-yl]-,(4S)-](https://resource.alfa-chemistry.com/structure/90719-29-2.gif)
CAS
90719-29-2 Purity
96%
90719-29-2 Purity
96%
