What is the molecular formula of Benzoic acid, 4-[(6-methyl-2-pyrazinyl)oxy]-,ethyl ester?
The molecular formula is C14H14N2O3.
When was Benzoic acid, 4-[(6-methyl-2-pyrazinyl)oxy]-,ethyl ester created and modified according to PubChem CID 24229695?
It was created on 2008-02-29 and last modified on 2023-12-30.
What is the IUPAC name of Benzoic acid, 4-[(6-methyl-2-pyrazinyl)oxy]-,ethyl ester?
The IUPAC name is ethyl 4-(6-methylpyrazin-2-yl)oxybenzoate.
What is the InChI of Benzoic acid, 4-[(6-methyl-2-pyrazinyl)oxy]-,ethyl ester?
The InChI is InChI=1S/C14H14N2O3/c1-3-18-14(17)11-4-6-12(7-5-11)19-13-9-15-8-10(2)16-13/h4-9H,3H2,1-2H3.
What is the InChIKey of Benzoic acid, 4-[(6-methyl-2-pyrazinyl)oxy]-,ethyl ester?
The InChIKey is LIMMDGVTHPQONZ-UHFFFAOYSA-N.
What is the Canonical SMILES of Benzoic acid, 4-[(6-methyl-2-pyrazinyl)oxy]-,ethyl ester?
The Canonical SMILES is CCOC(=O)C1=CC=C(C=C1)OC2=NC(=CN=C2)C.
What is the CAS number of Benzoic acid, 4-[(6-methyl-2-pyrazinyl)oxy]-,ethyl ester?
The CAS number is 906353-03-5.
What is the molecular weight of Benzoic acid, 4-[(6-methyl-2-pyrazinyl)oxy]-,ethyl ester?
The molecular weight is 258.27 g/mol.
Does Benzoic acid, 4-[(6-methyl-2-pyrazinyl)oxy]-,ethyl ester have hydrogen bond donor count?
No, it does not have any hydrogen bond donor count.
Is Benzoic acid, 4-[(6-methyl-2-pyrazinyl)oxy]-,ethyl ester a canonicalized compound?
Yes, it is a canonicalized compound.