What is the molecular formula of (1-Acetyl-2,3-dihydro-1H-indol-5-yl)boronic acid?
The molecular formula is C10H12BNO3.
What is the molecular weight of (1-Acetyl-2,3-dihydro-1H-indol-5-yl)boronic acid?
The molecular weight is 205.02 g/mol.
When was (1-Acetyl-2,3-dihydro-1H-indol-5-yl)boronic acid created?
It was created on December 27, 2013.
When was (1-Acetyl-2,3-dihydro-1H-indol-5-yl)boronic acid last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of (1-Acetyl-2,3-dihydro-1H-indol-5-yl)boronic acid?
The IUPAC name is (1-acetyl-2,3-dihydroindol-5-yl)boronic acid.
What is the InChI of (1-Acetyl-2,3-dihydro-1H-indol-5-yl)boronic acid?
The InChI is InChI=1S/C10H12BNO3/c1-7(13)12-5-4-8-6-9(11(14)15)2-3-10(8)12/h2-3,6,14-15H,4-5H2,1H3.
What is the InChIKey of (1-Acetyl-2,3-dihydro-1H-indol-5-yl)boronic acid?
The InChIKey is IERYXDICIURWMB-UHFFFAOYSA-N.
What is the canonical SMILES of (1-Acetyl-2,3-dihydro-1H-indol-5-yl)boronic acid?
The canonical SMILES is B(C1=CC2=C(C=C1)N(CC2)C(=O)C)(O)O.
How many hydrogen bond donor counts does (1-Acetyl-2,3-dihydro-1H-indol-5-yl)boronic acid have?
It has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does (1-Acetyl-2,3-dihydro-1H-indol-5-yl)boronic acid have?
It has 3 hydrogen bond acceptor counts.