What is the molecular formula of Bicyclo[2.2.1]heptane,2-ethylidene-6-isopropoxy?
The molecular formula is C12H20O.
What is the molecular weight of Bicyclo[2.2.1]heptane,2-ethylidene-6-isopropoxy?
The molecular weight is 180.29 g/mol.
What is the IUPAC name of Bicyclo[2.2.1]heptane,2-ethylidene-6-isopropoxy?
The IUPAC name is (1S,2E,4R)-2-ethylidene-6-propan-2-yloxybicyclo[2.2.1]heptane.
What is the InChI of Bicyclo[2.2.1]heptane,2-ethylidene-6-isopropoxy?
The InChI is InChI=1S/C12H20O/c1-4-10-5-9-6-11(10)12(7-9)13-8(2)3/h4,8-9,11-12H,5-7H2,1-3H3/b10-4+/t9-,11-,12?/m0/s1.
What is the InChIKey of Bicyclo[2.2.1]heptane,2-ethylidene-6-isopropoxy?
The InChIKey is DFAHIMHECXLSIS-BMKPUPTLSA-N.
What is the canonical SMILES of Bicyclo[2.2.1]heptane,2-ethylidene-6-isopropoxy?
The canonical SMILES is CC=C1CC2CC1C(C2)OC(C)C.
What is the XLogP3-AA value of Bicyclo[2.2.1]heptane,2-ethylidene-6-isopropoxy?
The XLogP3-AA value is 2.5.
How many hydrogen bond donor counts does Bicyclo[2.2.1]heptane,2-ethylidene-6-isopropoxy have?
It has 0 hydrogen bond donor counts.
What is the topological polar surface area of Bicyclo[2.2.1]heptane,2-ethylidene-6-isopropoxy?
The topological polar surface area is 9.2 ?2.