What is the molecular formula of 3-Fluoro-N,N-diisopropyl-5-trifluoromethyl-benzamide?
The molecular formula is C14H17F4NO.
When was 3-Fluoro-N,N-diisopropyl-5-trifluoromethyl-benzamide first created and modified in PubChem?
It was first created on 2009-09-25 and last modified on 2023-12-30.
What is the IUPAC Name of 3-Fluoro-N,N-diisopropyl-5-trifluoromethyl-benzamide?
The IUPAC Name is 3-fluoro-N,N-di(propan-2-yl)-5-(trifluoromethyl)benzamide.
What is the InChI of 3-Fluoro-N,N-diisopropyl-5-trifluoromethyl-benzamide?
The InChI is InChI=1S/C14H17F4NO/c1-8(2)19(9(3)4)13(20)10-5-11(14(16,17)18)7-12(15)6-10/h5-9H,1-4H3.
What is the Canonical SMILES of 3-Fluoro-N,N-diisopropyl-5-trifluoromethyl-benzamide?
The Canonical SMILES is CC(C)N(C(C)C)C(=O)C1=CC(=CC(=C1)F)C(F)(F)F.
What is the Molecular Weight of 3-Fluoro-N,N-diisopropyl-5-trifluoromethyl-benzamide?
The Molecular Weight is 291.28 g/mol.
How many Hydrogen Bond Acceptor Count does 3-Fluoro-N,N-diisopropyl-5-trifluoromethyl-benzamide have?
It has 5 Hydrogen Bond Acceptor Count.
What is the Topological Polar Surface Area of 3-Fluoro-N,N-diisopropyl-5-trifluoromethyl-benzamide?
The Topological Polar Surface Area is 20.3 Ų.
Does 3-Fluoro-N,N-diisopropyl-5-trifluoromethyl-benzamide have a defined atom stereocenter count?
No, it does not have a defined atom stereocenter count.
Is 3-Fluoro-N,N-diisopropyl-5-trifluoromethyl-benzamide a canonicalized compound in PubChem?
Yes, it is a canonicalized compound.