What is the molecular formula of 6-Nitroimidazo[1,2-a]pyridine-2-carboxylic acid?
The molecular formula is C8H5N3O4.
What is the molecular weight of 6-Nitroimidazo[1,2-a]pyridine-2-carboxylic acid?
The molecular weight is 207.14 g/mol.
When was 6-Nitroimidazo[1,2-a]pyridine-2-carboxylic acid created and modified in PubChem?
It was created on September 8, 2005, and last modified on December 30, 2023.
What is the IUPAC name of 6-Nitroimidazo[1,2-a]pyridine-2-carboxylic acid?
The IUPAC name is 6-nitroimidazo[1,2-a]pyridine-2-carboxylic acid.
What is the InChI of 6-Nitroimidazo[1,2-a]pyridine-2-carboxylic acid?
The InChI is InChI=1S/C8H5N3O4/c12-8(13)6-4-10-3-5(11(14)15)1-2-7(10)9-6/h1-4H,(H,12,13).
What is the InChIKey of 6-Nitroimidazo[1,2-a]pyridine-2-carboxylic acid?
The InChIKey is DMZAUINNDYXDKV-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 6-Nitroimidazo[1,2-a]pyridine-2-carboxylic acid have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 6-Nitroimidazo[1,2-a]pyridine-2-carboxylic acid?
The topological polar surface area is 100 Å2.
Does 6-Nitroimidazo[1,2-a]pyridine-2-carboxylic acid have any defined atom or bond stereocenters?
No, it has 0 defined atom or bond stereocenters.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.