CAS
904369-49-9 Purity
96%
904369-49-9 Purity
96%
Inquiry Basket
ACETAMIDE,N-[2-(PYRIDIN-4-YLTHIO)ETHYL]-
CAS
90437-15-3
Catalog Number
ACM90437153
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound ACETAMIDE, N-[2-(PYRIDIN-4-YLTHIO)ETHYL]-?
The molecular formula is C9H12N2OS.
When was the compound first created?
The compound was first created on December 4, 2007.
What is the IUPAC name of the compound?
The IUPAC name is N-(2-pyridin-4-ylsulfanylethyl)acetamide.
How is the compound represented by InChI?
The compound is represented by the InChI code InChI=1S/C9H12N2OS/c1-8(12)11-6-7-13-9-2-4-10-5-3-9/h2-5H,6-7H2,1H3,(H,11,12).
What is the Canonical SMILES representation of the compound?
The Canonical SMILES representation is CC(=O)NCCSC1=CC=NC=C1.
What is the molecular weight of the compound?
The molecular weight is 196.27 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 1 hydrogen bond donor count.
What is the Exact Mass of the compound?
The Exact Mass is 196.06703418 g/mol.
How many rotatable bond counts does the compound have?
The compound has 4 rotatable bond counts.
Is the compound Canonicalized?
Yes, the compound is canonicalized.
Recommended Products
![ACETAMIDE,N-[2-(PYRIDIN-2-YLTHIO)ETHYL]-](https://resource.alfa-chemistry.com/structure/90437-14-2.gif)
