90429-30-4 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 4-(2-Fluoro-phenyl)-4-oxo-butyric acid is C10H9FO3.
The molecular weight of 4-(2-Fluoro-phenyl)-4-oxo-butyric acid is 196.17 g/mol.
The IUPAC Name of 4-(2-Fluoro-phenyl)-4-oxo-butyric acid is 4-(2-fluorophenyl)-4-oxobutanoic acid.
The Canonical SMILES representation of 4-(2-Fluoro-phenyl)-4-oxo-butyric acid is C1=CC=C(C(=C1)C(=O)CCC(=O)O)F.
4-(2-Fluoro-phenyl)-4-oxo-butyric acid has 1 hydrogen bond donor count.
The topological polar surface area of 4-(2-Fluoro-phenyl)-4-oxo-butyric acid is 54.4 Å2.
4-(2-Fluoro-phenyl)-4-oxo-butyric acid has 0 defined atom stereocenter counts.
The exact mass of 4-(2-Fluoro-phenyl)-4-oxo-butyric acid is 196.05357231 g/mol.
Yes, 4-(2-Fluoro-phenyl)-4-oxo-butyric acid is canonicalized.
The complexity value of 4-(2-Fluoro-phenyl)-4-oxo-butyric acid is 227.