CAS
90416-47-0 Purity
96%
90416-47-0 Purity
96%
Shopping basket
4-Hydroxy-8-methoxycinnoline
CAS
90417-27-9
Catalog Number
ACM90417279
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 4-Hydroxy-8-methoxycinnoline?
The molecular formula of 4-Hydroxy-8-methoxycinnoline is C9H8N2O2.
What is the molecular weight of 4-Hydroxy-8-methoxycinnoline?
The molecular weight of 4-Hydroxy-8-methoxycinnoline is 176.17 g/mol.
What is the IUPAC name of 4-Hydroxy-8-methoxycinnoline?
The IUPAC name of 4-Hydroxy-8-methoxycinnoline is 8-methoxy-1H-cinnolin-4-one.
What is the InChI of 4-Hydroxy-8-methoxycinnoline?
The InChI of 4-Hydroxy-8-methoxycinnoline is InChI=1S/C9H8N2O2/c1-13-8-4-2-3-6-7(12)5-10-11-9(6)8/h2-5H,1H3,(H,11,12).
What is the InChIKey of 4-Hydroxy-8-methoxycinnoline?
The InChIKey of 4-Hydroxy-8-methoxycinnoline is VCZBHAXHTXDOHL-UHFFFAOYSA-N.
What is the canonical SMILES of 4-Hydroxy-8-methoxycinnoline?
The canonical SMILES of 4-Hydroxy-8-methoxycinnoline is COC1=CC=CC2=C1NN=CC2=O.
What is the CAS number of 4-Hydroxy-8-methoxycinnoline?
The CAS number of 4-Hydroxy-8-methoxycinnoline is 90417-27-9.
What is the molecular weight of 4-Hydroxy-8-methoxycinnoline as computed by PubChem?
The molecular weight of 4-Hydroxy-8-methoxycinnoline as computed by PubChem is 176.17 g/mol.
How many hydrogen bond donor counts does 4-Hydroxy-8-methoxycinnoline have?
4-Hydroxy-8-methoxycinnoline has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 4-Hydroxy-8-methoxycinnoline have?
4-Hydroxy-8-methoxycinnoline has 4 hydrogen bond acceptor counts.
Recommended Products
