90390-15-1 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C8H9F2N.
The IUPAC name of the compound is 1-(3,5-difluorophenyl)-N-methylmethanamine.
The InChI of the compound is InChI=1S/C8H9F2N/c1-11-5-6-2-7(9)4-8(10)3-6/h2-4,11H,5H2,1H3.
The InChIKey of the compound is PAVCYIWPONYGCE-UHFFFAOYSA-N.
The molecular weight of the compound is 157.16 g/mol.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.
The compound has 2 rotatable bond counts.
The topological polar surface area of the compound is 12.2.
Yes, the compound is the canonicalized form.