What is the molecular formula of Benzene, 2-(bromomethyl)-3-chloro-1,4-difluoro according to the reference?
The molecular formula is C7H4BrClF2.
What is the molecular weight of Benzene, 2-(bromomethyl)-3-chloro-1,4-difluoro?
The molecular weight is 241.46 g/mol.
What are the synonyms for Benzene, 2-(bromomethyl)-3-chloro-1,4-difluoro?
Some synonyms include 2-Chloro-3,6-difluorobenzyl bromide and 2-(bromomethyl)-3-chloro-1,4-difluorobenzene.
What is the Canonical SMILES representation of Benzene, 2-(bromomethyl)-3-chloro-1,4-difluoro?
The Canonical SMILES is C1=CC(=C(C(=C1F)CBr)Cl)F.
What is the InChIKey of Benzene, 2-(bromomethyl)-3-chloro-1,4-difluoro?
The InChIKey is KAADKOQBKOGBAA-UHFFFAOYSA-N.
How many hydrogen bond acceptor counts does Benzene, 2-(bromomethyl)-3-chloro-1,4-difluoro have?
It has 2 hydrogen bond acceptor counts.
What is the exact mass of Benzene, 2-(bromomethyl)-3-chloro-1,4-difluoro?
The exact mass is 239.91530 g/mol.
Does Benzene, 2-(bromomethyl)-3-chloro-1,4-difluoro have any defined atom stereocenter count?
No, it does not have any defined atom stereocenter count.
What is the topological polar surface area of Benzene, 2-(bromomethyl)-3-chloro-1,4-difluoro?
The topological polar surface area is 0-2.
Is Benzene, 2-(bromomethyl)-3-chloro-1,4-difluoro considered as a canonicalized compound?
Yes, it is considered as a canonicalized compound.