CAS
916792-33-1 Purity
---
916792-33-1 Purity
---
Inquiry Basket
1-Boc-3-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidine
CAS
902837-24-5
Catalog Number
ACM902837245
Category
Other Products
Molecular Weight
295.39
Molecular Formula
C15H25N3O3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1-Boc-3-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidine?
The molecular formula is C15H25N3O3.
When was 1-Boc-3-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidine created?
It was created on 2010-03-14.
What is the computed molecular weight of 1-Boc-3-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidine?
The computed molecular weight is 295.38 g/mol.
What is the IUPAC name of 1-Boc-3-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidine?
The IUPAC name is tert-butyl 3-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidine-1-carboxylate.
What is the Canonical SMILES of 1-Boc-3-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidine?
The Canonical SMILES is CC(C)C1=NOC(=N1)C2CCCN(C2)C(=O)OC(C)(C)C.
What is the CAS number of 1-Boc-3-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidine?
The CAS number is 902837-24-5.
How many hydrogen bond acceptors are there in 1-Boc-3-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidine?
There are 5 hydrogen bond acceptors.
What is the topological polar surface area of 1-Boc-3-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidine?
The topological polar surface area is 68.5 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
How many rotatable bond counts are there in 1-Boc-3-(3-isopropyl-1,2,4-oxadiazol-5-yl)piperidine?
There are 4 rotatable bonds.
Recommended Products
![1-Boc-3-[3-(N-propyl)-1,2,4-oxadiazol-5-yl]piperidine](https://resource.alfa-chemistry.com/structure/902837-23-4.gif)
![N-Propyl-4-[(3S)-pyrrolidinyloxy]benzamide](https://resource.alfa-chemistry.com/structure/1212151-59-1.gif)
