What is the molecular formula of N-tert-Butyl-2-(3-piperidinyloxy)acetamide?
The molecular formula is C11H22N2O2.
What is the molecular weight of N-tert-Butyl-2-(3-piperidinyloxy)acetamide?
The molecular weight is 214.30 g/mol.
What is the IUPAC name of N-tert-Butyl-2-(3-piperidinyloxy)acetamide?
The IUPAC name is N-tert-butyl-2-piperidin-3-yloxyacetamide.
What is the InChI of N-tert-Butyl-2-(3-piperidinyloxy)acetamide?
The InChI is InChI=1S/C11H22N2O2/c1-11(2,3)13-10(14)8-15-9-5-4-6-12-7-9/h9,12H,4-8H2,1-3H3,(H,13,14).
What is the InChIKey of N-tert-Butyl-2-(3-piperidinyloxy)acetamide?
The InChIKey is RHZARILSPOXHFP-UHFFFAOYSA-N.
What is the Canonical SMILES of N-tert-Butyl-2-(3-piperidinyloxy)acetamide?
The Canonical SMILES is CC(C)(C)NC(=O)COC1CCCNC1.
How many hydrogen bond donor counts does N-tert-Butyl-2-(3-piperidinyloxy)acetamide have?
It has 2 hydrogen bond donor counts.
What is the XLogP3-AA value of N-tert-Butyl-2-(3-piperidinyloxy)acetamide?
The XLogP3-AA value is 0.5.
How many rotatable bond counts does N-tert-Butyl-2-(3-piperidinyloxy)acetamide have?
It has 4 rotatable bond counts.
Is N-tert-Butyl-2-(3-piperidinyloxy)acetamide a canonicalized compound?
Yes, it is a canonicalized compound.