What is the molecular formula of 2-Chlorobenzothiazole-5-carboxylic acid methyl ester?
The molecular formula is C9H6ClNO2S.
What are some synonyms for 2-Chlorobenzothiazole-5-carboxylic acid methyl ester?
Some synonyms include METHYL 2-CHLOROBENZO[D]THIAZOLE-5-CARBOXYLATE and METHYL 2-CHLORO-1,3-BENZOTHIAZOLE-5-CARBOXYLATE.
What is the molecular weight of 2-Chlorobenzothiazole-5-carboxylic acid methyl ester?
The molecular weight is 227.67 g/mol.
What is the IUPAC name of 2-Chlorobenzothiazole-5-carboxylic acid methyl ester?
The IUPAC name is methyl 2-chloro-1,3-benzothiazole-5-carboxylate.
What is the InChI of 2-Chlorobenzothiazole-5-carboxylic acid methyl ester?
The InChI is InChI=1S/C9H6ClNO2S/c1-13-8(12)5-2-3-7-6(4-5)11-9(10)14-7/h2-4H,1H3.
How many hydrogen bond donor counts are there in 2-Chlorobenzothiazole-5-carboxylic acid methyl ester?
There are 0 hydrogen bond donor counts.
What is the XLogP3-AA value of 2-Chlorobenzothiazole-5-carboxylic acid methyl ester?
The XLogP3-AA value is 3.2.
What is the topological polar surface area of 2-Chlorobenzothiazole-5-carboxylic acid methyl ester?
The topological polar surface area is 67.4 Ų.
How many rotatable bond counts are there in 2-Chlorobenzothiazole-5-carboxylic acid methyl ester?
There are 2 rotatable bond counts.
Is 2-Chlorobenzothiazole-5-carboxylic acid methyl ester a canonicalized compound?
Yes, it is a canonicalized compound.