What is the molecular formula of 1,2-Dimethyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid?
The molecular formula is C8H9NO3.
What is the molecular weight of 1,2-Dimethyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid?
The molecular weight is 167.16 g/mol.
What is the IUPAC name of 1,2-Dimethyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid?
The IUPAC name is 1,2-dimethyl-4-oxopyridine-3-carboxylic acid.
What is the InChI of 1,2-Dimethyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid?
The InChI is InChI=1S/C8H9NO3/c1-5-7(8(11)12)6(10)3-4-9(5)2/h3-4H,1-2H3,(H,11,12).
What is the InChIKey of 1,2-Dimethyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid?
The InChIKey is IMBSFSVOMKOTCW-UHFFFAOYSA-N.
What is the Canonical SMILES of 1,2-Dimethyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid?
The Canonical SMILES is CC1=C(C(=O)C=CN1C)C(=O)O.
What is the XLogP3-AA value of 1,2-Dimethyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid?
The XLogP3-AA value is 0.9.
How many hydrogen bond donor counts does 1,2-Dimethyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 1,2-Dimethyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid?
The topological polar surface area is 57.6 Ų.
Is 1,2-Dimethyl-4-oxo-1,4-dihydropyridine-3-carboxylic acid the canonicalized compound?
Yes, it is the canonicalized compound.