What is the molecular formula of Carbamic acid, N-(4-methyl-2-pyridinyl)-, 1,1-dimethylethyl ester?
The molecular formula is C11H16N2O2.
What is the molecular weight of Carbamic acid, N-(4-methyl-2-pyridinyl)-, 1,1-dimethylethyl ester?
The molecular weight is 208.26 g/mol.
What is the IUPAC name of Carbamic acid, N-(4-methyl-2-pyridinyl)-, 1,1-dimethylethyl ester?
The IUPAC name is tert-butyl N-(4-methylpyridin-2-yl)carbamate.
What is the InChI of Carbamic acid, N-(4-methyl-2-pyridinyl)-, 1,1-dimethylethyl ester?
The InChI is InChI=1S/C11H16N2O2/c1-8-5-6-12-9(7-8)13-10(14)15-11(2,3)4/h5-7H,1-4H3,(H,12,13,14).
What is the Canonical SMILES of Carbamic acid, N-(4-methyl-2-pyridinyl)-, 1,1-dimethylethyl ester?
The Canonical SMILES is CC1=CC(=NC=C1)NC(=O)OC(C)(C)C.
What is the CAS number of Carbamic acid, N-(4-methyl-2-pyridinyl)-, 1,1-dimethylethyl ester?
The CAS number is 90101-20-5.
What is the XLogP3-AA value of Carbamic acid, N-(4-methyl-2-pyridinyl)-, 1,1-dimethylethyl ester?
The XLogP3-AA value is 2.1.
How many hydrogen bond donor counts does Carbamic acid, N-(4-methyl-2-pyridinyl)-, 1,1-dimethylethyl ester have?
It has 1 hydrogen bond donor count.
How many rotatable bond counts does Carbamic acid, N-(4-methyl-2-pyridinyl)-, 1,1-dimethylethyl ester have?
It has 3 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized.