CAS
9005-34-9 Purity
---
9005-34-9 Purity
---
Shopping basket
sodium alginate
CAS
9005-38-0
Catalog Number
ACM9005380
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of sodium alginate?
The molecular formula of sodium alginate is C16H23NO7.
What is the molecular weight of sodium alginate?
The molecular weight of sodium alginate is 341.36 g/mol.
What is the synonym for sodium alginate?
Some synonyms for sodium alginate include Phendimetrazine tartrate, Statobex, Plegine, and Adphen.
How does sodium alginate work in the body?
Sodium alginate is a prodrug that is hydrolyzed to the active metabolite phenmetrazine, which competes with norepinephrine and dopamine for their presynaptic transporters, thereby blocking the reuptake of these monoamines at neuronal junctions.
What are the properties of sodium alginate in terms of hydrogen bond donor count, hydrogen bond acceptor count, rotatable bond count, exact mass, monoistopic mass, topological polar surface area, heavy atom count, and formal charge?
Sodium alginate has 4 hydrogen bond donor counts, 8 hydrogen bond acceptor counts, 4 rotatable bond counts, an exact mass of 341.14745207 g/mol, a monoistopic mass of 341.14745207 g/mol, a topological polar surface area of 128Ų, 24 heavy atom count, and a formal charge.
What are the component compounds of sodium alginate?
The component compounds of sodium alginate include CID 30487 (Phendimetrazine) and CID 444305 (L-Tartaric acid).
When was sodium alginate created and last modified?
Sodium alginate was created on June 24, 2005, and last modified on December 30, 2023.
What is the InChIKey of sodium alginate?
The InChIKey of sodium alginate is VEPOHXYIFQMVHW-PVJVQHJQSA-N.
What is the Canonical SMILES of sodium alginate?
The Canonical SMILES of sodium alginate is CC1C(OCCN1C)C2=CC=CC=C2.C(C(C(=O)O)O)(C(=O)O)O.
What are some other identifiers of sodium alginate, such as CAS and UNII numbers?
Other identifiers for sodium alginate include CAS number 50-58-8, UNII 6985IP0T80, and DSSTox Substance ID DTXSID70198165.
Recommended Products
