CAS
90007-06-0 Purity
---
90007-06-0 Purity
---
Inquiry Basket
Methyl 6-methyl-2-(methylthio)pyrimidine-4-carboxylate
CAS
90007-36-6
Catalog Number
ACM90007366
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Methyl 6-methyl-2-(methylthio)pyrimidine-4-carboxylate?
The molecular formula is C8H10N2O2S.
What is the molecular weight of Methyl 6-methyl-2-(methylthio)pyrimidine-4-carboxylate?
The molecular weight is 198.24 g/mol.
What is the IUPAC name of Methyl 6-methyl-2-(methylthio)pyrimidine-4-carboxylate?
The IUPAC name is methyl 6-methyl-2-methylsulfanylpyrimidine-4-carboxylate.
What is the InChI code of Methyl 6-methyl-2-(methylthio)pyrimidine-4-carboxylate?
The InChI code is InChI=1S/C8H10N2O2S/c1-5-4-6(7(11)12-2)10-8(9-5)13-3/h4H,1-3H3.
What is the InChIKey of Methyl 6-methyl-2-(methylthio)pyrimidine-4-carboxylate?
The InChIKey is HMJWTOFSFHDFDA-UHFFFAOYSA-N.
What is the canonical SMILES of Methyl 6-methyl-2-(methylthio)pyrimidine-4-carboxylate?
The canonical SMILES is CC1=CC(=NC(=N1)SC)C(=O)OC.
What is the CAS number of Methyl 6-methyl-2-(methylthio)pyrimidine-4-carboxylate?
The CAS number is 90007-36-6.
How many hydrogen bond donor counts does Methyl 6-methyl-2-(methylthio)pyrimidine-4-carboxylate have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Methyl 6-methyl-2-(methylthio)pyrimidine-4-carboxylate have?
It has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does Methyl 6-methyl-2-(methylthio)pyrimidine-4-carboxylate have?
It has 3 rotatable bond counts.
Recommended Products
