89-94-1 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C7H10N2O.
The molecular weight of the compound is 138.17 g/mol.
The IUPAC name of the compound is 5-cyclobutyl-1,3-oxazol-2-amine.
The InChI of the compound is InChI=1S/C7H10N2O/c8-7-9-4-6(10-7)5-2-1-3-5/h4-5H,1-3H2,(H2,8,9).
The InChIKey of the compound is YBSCFSNWVUODEV-UHFFFAOYSA-N.
The Canonical SMILES of the compound is C1CC(C1)C2=CN=C(O2)N.
The CAS number of the compound is 899421-56-8.
The XLogP3-AA value of the compound is 1.1.
The compound has 1 hydrogen bond donor count.
The compound has 3 hydrogen bond acceptor counts.