What is the molecular formula of Cyclohexyl 2-(2,4-dimethylphenyl)ethyl ketone?
The molecular formula is C17H24O.
When was Cyclohexyl 2-(2,4-dimethylphenyl)ethyl ketone created and modified?
It was created on 2008-02-29 and last modified on 2023-12-30.
What is the IUPAC name of Cyclohexyl 2-(2,4-dimethylphenyl)ethyl ketone?
The IUPAC name is 1-cyclohexyl-3-(2,4-dimethylphenyl)propan-1-one.
What is the InChI of Cyclohexyl 2-(2,4-dimethylphenyl)ethyl ketone?
The InChI is InChI=1S/C17H24O/c1-13-8-9-15(14(2)12-13)10-11-17(18)16-6-4-3-5-7-16/h8-9,12,16H,3-7,10-11H2,1-2H3.
What is the InChIKey of Cyclohexyl 2-(2,4-dimethylphenyl)ethyl ketone?
The InChIKey is LZWHAMVGCFTGLE-UHFFFAOYSA-N.
What is the Canonical SMILES of Cyclohexyl 2-(2,4-dimethylphenyl)ethyl ketone?
The Canonical SMILES is CC1=CC(=C(C=C1)CCC(=O)C2CCCCC2.
What is the molecular weight of Cyclohexyl 2-(2,4-dimethylphenyl)ethyl ketone?
The molecular weight is 244.37 g/mol.
What is the XLogP3-AA value of Cyclohexyl 2-(2,4-dimethylphenyl)ethyl ketone?
The XLogP3-AA value is 4.6.
How many hydrogen bond donor counts does Cyclohexyl 2-(2,4-dimethylphenyl)ethyl ketone have?
It has 0 hydrogen bond donor counts.
Is Cyclohexyl 2-(2,4-dimethylphenyl)ethyl ketone a canonicalized compound according to PubChem?
Yes, it is a canonicalized compound.