What is the molecular formula of Cyclopropyl 3-(piperidinomethyl)phenyl ketone?
The molecular formula is C16H21NO.
When was Cyclopropyl 3-(piperidinomethyl)phenyl ketone created and last modified?
It was created on 2008-02-29 and last modified on 2023-12-30.
What is the IUPAC name of Cyclopropyl 3-(piperidinomethyl)phenyl ketone?
The IUPAC name is cyclopropyl-[3-(piperidin-1-ylmethyl)phenyl]methanone.
What is the InChI of Cyclopropyl 3-(piperidinomethyl)phenyl ketone?
The InChI is InChI=1S/C16H21NO/c18-16(14-7-8-14)15-6-4-5-13(11-15)12-17-9-2-1-3-10-17/h4-6,11,14H,1-3,7-10,12H2.
What is the Canonical SMILES of Cyclopropyl 3-(piperidinomethyl)phenyl ketone?
The Canonical SMILES is C1CCN(CC1)CC2=CC(=CC=C2)C(=O)C3CC3.
What is the molecular weight of Cyclopropyl 3-(piperidinomethyl)phenyl ketone?
The molecular weight is 243.34 g/mol.
How many Hydrogen Bond Acceptor Count does Cyclopropyl 3-(piperidinomethyl)phenyl ketone have?
It has 2 Hydrogen Bond Acceptor Count.
What is the exact mass of Cyclopropyl 3-(piperidinomethyl)phenyl ketone?
The exact mass is 243.162314293 g/mol.
How many Rotatable Bond Count does Cyclopropyl 3-(piperidinomethyl)phenyl ketone have?
It has 4 Rotatable Bond Count.
Is Cyclopropyl 3-(piperidinomethyl)phenyl ketone a canonicalized compound?
Yes, it is a canonicalized compound.