What is the molecular formula of Cyclohexyl 2-(2,3-dimethylphenyl)ethyl ketone?
The molecular formula is C17H24O.
What is the molecular weight of Cyclohexyl 2-(2,3-dimethylphenyl)ethyl ketone?
The molecular weight is 244.37 g/mol.
What is the IUPAC name of Cyclohexyl 2-(2,3-dimethylphenyl)ethyl ketone?
The IUPAC name is 1-cyclohexyl-3-(2,3-dimethylphenyl)propan-1-one.
What is the InChI of Cyclohexyl 2-(2,3-dimethylphenyl)ethyl ketone?
The InChI is InChI=1S/C17H24O/c1-13-7-6-10-15(14(13)2)11-12-17(18)16-8-4-3-5-9-16/h6-7,10,16H,3-5,8-9,11-12H2,1-2H3.
What is the InChIKey of Cyclohexyl 2-(2,3-dimethylphenyl)ethyl ketone?
The InChIKey is XZLUOTXRQAPORH-UHFFFAOYSA-N.
What is the Canonical SMILES of Cyclohexyl 2-(2,3-dimethylphenyl)ethyl ketone?
The Canonical SMILES is CC1=C(C(=CC=C1)CCC(=O)C2CCCCC2).
What is the CAS number of Cyclohexyl 2-(2,3-dimethylphenyl)ethyl ketone?
The CAS number is 898793-49-2.
How many hydrogen bond donor counts are there in Cyclohexyl 2-(2,3-dimethylphenyl)ethyl ketone?
There are 0 hydrogen bond donor counts.
What is the XLogP3-AA value of Cyclohexyl 2-(2,3-dimethylphenyl)ethyl ketone?
The XLogP3-AA value is 4.6.
Is the compound canonicalized for Cyclohexyl 2-(2,3-dimethylphenyl)ethyl ketone?
Yes, the compound is canonicalized.