What is the molecular formula of Cyclobutyl 2-(2,3-dimethylphenyl)ethyl ketone?
The molecular formula is C15H20O.
What is the molecular weight of Cyclobutyl 2-(2,3-dimethylphenyl)ethyl ketone?
The molecular weight is 216.32 g/mol.
What is the IUPAC name of Cyclobutyl 2-(2,3-dimethylphenyl)ethyl ketone?
The IUPAC name is 1-cyclobutyl-3-(2,3-dimethylphenyl)propan-1-one.
What is the InChI of Cyclobutyl 2-(2,3-dimethylphenyl)ethyl ketone?
The InChI is InChI=1S/C15H20O/c1-11-5-3-6-13(12(11)2)9-10-15(16)14-7-4-8-14/h3,5-6,14H,4,7-10H2,1-2H3.
What is the InChIKey of Cyclobutyl 2-(2,3-dimethylphenyl)ethyl ketone?
The InChIKey is WOPVFPDAHLIWBG-UHFFFAOYSA-N.
How many hydrogen bond donor count does Cyclobutyl 2-(2,3-dimethylphenyl)ethyl ketone have?
It has 0 hydrogen bond donor count.
What is the XLogP3-AA value of Cyclobutyl 2-(2,3-dimethylphenyl)ethyl ketone?
The XLogP3-AA value is 3.6.
How many rotatable bond count does Cyclobutyl 2-(2,3-dimethylphenyl)ethyl ketone have?
It has 4 rotatable bond count.
What is the topological polar surface area of Cyclobutyl 2-(2,3-dimethylphenyl)ethyl ketone?
The topological polar surface area is 17.1 Ų.
Is Cyclobutyl 2-(2,3-dimethylphenyl)ethyl ketone a canonicalized compound?
Yes, it is a canonicalized compound.