What is the molecular formula of 4-(2,6-Dimethoxyphenyl)-4-oxobutyric acid?
The molecular formula is C12H14O5.
What is the molecular weight of 4-(2,6-Dimethoxyphenyl)-4-oxobutyric acid?
The molecular weight is 238.24 g/mol.
What is the IUPAC name of 4-(2,6-Dimethoxyphenyl)-4-oxobutyric acid?
The IUPAC name is 4-(2,6-dimethoxyphenyl)-4-oxobutanoic acid.
What is the InChI of 4-(2,6-Dimethoxyphenyl)-4-oxobutyric acid?
The InChI is InChI=1S/C12H14O5/c1-16-9-4-3-5-10(17-2)12(9)8(13)6-7-11(14)15/h3-5H,6-7H2,1-2H3,(H,14,15).
What is the InChIKey of 4-(2,6-Dimethoxyphenyl)-4-oxobutyric acid?
The InChIKey is SSGFEFAIKLRWNZ-UHFFFAOYSA-N.
What is the Canonical SMILES of 4-(2,6-Dimethoxyphenyl)-4-oxobutyric acid?
The Canonical SMILES is COC1=C(C(=CC=C1)OC)C(=O)CCC(=O)O.
How many hydrogen bond donor counts does 4-(2,6-Dimethoxyphenyl)-4-oxobutyric acid have?
It has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 4-(2,6-Dimethoxyphenyl)-4-oxobutyric acid have?
It has 5 hydrogen bond acceptor counts.
What is the topological polar surface area of 4-(2,6-Dimethoxyphenyl)-4-oxobutyric acid?
The topological polar surface area is 72.8 Ų.
Is 4-(2,6-Dimethoxyphenyl)-4-oxobutyric acid a canonicalized compound?
Yes, it is a canonicalized compound.