What is the molecular formula of cyclobutyl 3-(morpholinomethyl)phenyl ketone?
The molecular formula is C16H21NO2.
What is the molecular weight of cyclobutyl 3-(morpholinomethyl)phenyl ketone?
The molecular weight is 259.34 g/mol.
What is the IUPAC name of cyclobutyl 3-(morpholinomethyl)phenyl ketone?
The IUPAC name is cyclobutyl-[3-(morpholin-4-ylmethyl)phenyl]methanone.
What is the InChI of cyclobutyl 3-(morpholinomethyl)phenyl ketone?
The InChI is InChI=1S/C16H21NO2/c18-16(14-4-2-5-14)15-6-1-3-13(11-15)12-17-7-9-19-10-8-17/h1,3,6,11,14H,2,4-5,7-10,12H2.
What is the Canonical SMILES of cyclobutyl 3-(morpholinomethyl)phenyl ketone?
The Canonical SMILES is C1CC(C1)C(=O)C2=CC=CC(=C2)CN3CCOCC3.
What is the CAS number of Cyclobutyl 3-(morpholinomethyl)phenyl ketone?
The CAS number is 898792-38-6.
What is the XLogP3-AA value of cyclobutyl 3-(morpholinomethyl)phenyl ketone?
The XLogP3-AA value is 2.1.
How many hydrogen bond donor counts does cyclobutyl 3-(morpholinomethyl)phenyl ketone have?
It has 0 hydrogen bond donor counts.
What is the topological polar surface area of cyclobutyl 3-(morpholinomethyl)phenyl ketone?
The topological polar surface area is 29.5 Ų.
Is cyclobutyl 3-(morpholinomethyl)phenyl ketone considered a canonicalized compound?
Yes, it is considered a canonicalized compound.