What is the molecular formula of Cyclopropyl 3,5-dichlorophenyl ketone?
The molecular formula is C10H8Cl2O.
When was Cyclopropyl 3,5-dichlorophenyl ketone created and modified in PubChem?
It was created on February 29, 2008, and last modified on December 30, 2023.
What is the IUPAC name of Cyclopropyl 3,5-dichlorophenyl ketone?
The IUPAC name is cyclopropyl-(3,5-dichlorophenyl)methanone.
What is the InChIKey of Cyclopropyl 3,5-dichlorophenyl ketone?
The InChIKey is KYRDLCHKSRBJQL-UHFFFAOYSA-N.
What is the canonical SMILES representation of Cyclopropyl 3,5-dichlorophenyl ketone?
The canonical SMILES is C1CC1C(=O)C2=CC(=CC(=C2)Cl)Cl.
What is the molecular weight of Cyclopropyl 3,5-dichlorophenyl ketone?
The molecular weight is 215.07 g/mol.
What is the CAS number of Cyclopropyl 3,5-dichlorophenyl ketone?
The CAS number is 898790-30-2.
How many hydrogen bond donor counts are there in Cyclopropyl 3,5-dichlorophenyl ketone?
There are 0 hydrogen bond donor counts.
What is the XLogP3-AA value of Cyclopropyl 3,5-dichlorophenyl ketone?
The XLogP3-AA value is 3.3.
Is Cyclopropyl 3,5-dichlorophenyl ketone a canonicalized compound in PubChem?
Yes, it is a canonicalized compound in PubChem.