What is the molecular formula of 2-Chloro-N-cyclohexylnicotinamide?
The molecular formula is C12H15ClN2O.
When was 2-Chloro-N-cyclohexylnicotinamide created and last modified?
It was created on 2005-08-09 and last modified on 2023-12-30.
What is the IUPAC name of 2-Chloro-N-cyclohexylnicotinamide?
The IUPAC name is 2-chloro-N-cyclohexylpyridine-3-carboxamide.
What is the InChIKey of 2-Chloro-N-cyclohexylnicotinamide?
The InChIKey is DWMGLWCQLGOYOC-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Chloro-N-cyclohexylnicotinamide?
The canonical SMILES is C1CCC(CC1)NC(=O)C2=C(N=CC=C2)Cl.
What is the molecular weight of 2-Chloro-N-cyclohexylnicotinamide?
The molecular weight is 238.71 g/mol.
How many hydrogen bond donor counts does 2-Chloro-N-cyclohexylnicotinamide have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 2-Chloro-N-cyclohexylnicotinamide?
The topological polar surface area is 42.2.
Does 2-Chloro-N-cyclohexylnicotinamide have any defined atom stereocenter counts?
No, it has 0 defined atom stereocenter counts.
Is 2-Chloro-N-cyclohexylnicotinamide a canonicalized compound?
Yes, it is a canonicalized compound.