What is the molecular formula of 3-Chloro-6-methylbenzo[b]thiophene-2-carbonylchloride?
The molecular formula is C10H6Cl2OS.
What is the molecular weight of 3-Chloro-6-methylbenzo[b]thiophene-2-carbonylchloride?
The molecular weight is 245.12 g/mol.
What is the IUPAC name of 3-Chloro-6-methylbenzo[b]thiophene-2-carbonylchloride?
The IUPAC name is 3-chloro-6-methyl-1-benzothiophene-2-carbonyl chloride.
What is the InChI code for 3-Chloro-6-methylbenzo[b]thiophene-2-carbonylchloride?
The InChI code is InChI=1S/C10H6Cl2OS/c1-5-2-3-6-7(4-5)14-9(8(6)11)10(12)13/h2-4H,1H3.
What is the InChIKey for 3-Chloro-6-methylbenzo[b]thiophene-2-carbonylchloride?
The InChIKey is UHRYEWIAYLVOIT-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 3-Chloro-6-methylbenzo[b]thiophene-2-carbonylchloride?
The Canonical SMILES is CC1=CC2=C(C=C1)C(=C(S2)C(=O)Cl)Cl.
How many hydrogen bond donor counts does 3-Chloro-6-methylbenzo[b]thiophene-2-carbonylchloride have?
It has 0 hydrogen bond donor counts.
What is the XlogP3-AA value of 3-Chloro-6-methylbenzo[b]thiophene-2-carbonylchloride?
The XLogP3-AA value is 4.8.
What is the topological polar surface area of 3-Chloro-6-methylbenzo[b]thiophene-2-carbonylchloride?
The topological polar surface area is 45.3 Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.