What is the molecular formula of (9E,12Z)-9,12-Tetradecadien-1-Ol Acetate?
The molecular formula is C16H28O2.
What is the molecular weight of (9E,12Z)-9,12-Tetradecadien-1-Ol Acetate?
The molecular weight is 252.39 g/mol.
What is the IUPAC name of (9E,12Z)-9,12-Tetradecadien-1-Ol Acetate?
The IUPAC name is [(9E,12Z)-tetradeca-9,12-dienyl] acetate.
What is the InChI of (9E,12Z)-9,12-Tetradecadien-1-Ol Acetate?
The InChI is InChI=1S/C16H28O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-16(2)17/h3-4,6-7H,5,8-15H2,1-2H3/b4-3-,7-6+.
What is the InChIKey of (9E,12Z)-9,12-Tetradecadien-1-Ol Acetate?
The InChIKey is ZZGJZGSVLNSDPG-WWVFNRLHSA-N.
What is the canonical SMILES representation of (9E,12Z)-9,12-Tetradecadien-1-Ol Acetate?
The canonical SMILES representation is CC=CCC=CCCCCCCCCOC(=O)C.
What is the CAS number of (9E,12Z)-9,12-Tetradecadien-1-Ol Acetate?
The CAS number is 31654-77-0.
How many hydrogen bond donor counts are there in (9E,12Z)-9,12-Tetradecadien-1-Ol Acetate?
There are 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in (9E,12Z)-9,12-Tetradecadien-1-Ol Acetate?
There are 2 hydrogen bond acceptor counts.
What is the topological polar surface area of (9E,12Z)-9,12-Tetradecadien-1-Ol Acetate?
The topological polar surface area is 26.3 Ų.