What is the molecular formula of 5,5-Dimethyl-4-hydroxymethyl-1-pyrroline N-Oxide?
The molecular formula is C7H13NO2.
What are the synonyms for 5,5-Dimethyl-4-hydroxymethyl-1-pyrroline N-Oxide?
The synonyms are 176793-52-5 and (2,2-dimethyl-1-oxido-3,4-dihydropyrrol-1-ium-3-yl)methanol.
What is the molecular weight of 5,5-Dimethyl-4-hydroxymethyl-1-pyrroline N-Oxide?
The molecular weight is 143.18 g/mol.
When was 5,5-Dimethyl-4-hydroxymethyl-1-pyrroline N-Oxide created?
It was created on March 29, 2010.
When was 5,5-Dimethyl-4-hydroxymethyl-1-pyrroline N-Oxide last modified?
It was last modified on October 21, 2023.
What is the IUPAC name of 5,5-Dimethyl-4-hydroxymethyl-1-pyrroline N-Oxide?
The IUPAC name is (2,2-dimethyl-1-oxido-3,4-dihydropyrrol-1-ium-3-yl)methanol.
What is the InChI of 5,5-Dimethyl-4-hydroxymethyl-1-pyrroline N-Oxide?
The InChI is InChI=1S/C7H13NO2/c1-7(2)6(5-9)3-4-8(7)10/h4,6,9H,3,5H2,1-2H3.
What is the InChIKey of 5,5-Dimethyl-4-hydroxymethyl-1-pyrroline N-Oxide?
The InChIKey is TUYOGUBDFMPSLK-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 5,5-Dimethyl-4-hydroxymethyl-1-pyrroline N-Oxide have?
It has 1 hydrogen bond donor count.
What is the topological polar surface area of 5,5-Dimethyl-4-hydroxymethyl-1-pyrroline N-Oxide?
The topological polar surface area is 49Ų.