C6-DPA

• CAS: 1258209-99-2
• Catalog Number: ACM1258209992
• Category: Organic Photovoltaic (OPV)

Custom Q&A

What is the molecular formula of C6-DPA?

The molecular formula of C6-DPA is C38H42.

When was C6-DPA created and modified?

C6-DPA was created on 2018-04-08 and modified on 2023-12-30.

What is the IUPAC name of C6-DPA?

The IUPAC name of C6-DPA is 2,6-bis(4-hexylphenyl)anthracene.

What is the molecular weight of C6-DPA?

The molecular weight of C6-DPA is 498.7 g/mol.

What is the InChI of C6-DPA?

The InChI of C6-DPA is InChI=1S/C38H42/c1-3-5-7-9-11-29-13-17-31(18-14-29)33-21-23-35-28-38-26-34(22-24-36(38)27-37(35)25-33)32-19-15-30(16-20-32)12-10-8-6-4-2/h13-28H,3-12H2,1-2H3.

What is the InChIKey of C6-DPA?

The InChIKey of C6-DPA is JINUCGGYXBOOGT-UHFFFAOYSA-N.

What is the Canonical SMILES of C6-DPA?

The Canonical SMILES of C6-DPA is CCCCCCC1=CC=C(C=C1)C2=CC3=CC4=C(C=C(C=C4)C5=CC=C(C=C5)CCCCCC)C=C3C=C2.

How many rotatable bond counts does C6-DPA have?

C6-DPA has 12 rotatable bond counts.

What is the XLogP3-AA value of C6-DPA?

The XLogP3-AA value of C6-DPA is 13.6.

Is the compound canonicalized?

Yes, the compound C6-DPA is canonicalized.