Bis(isooctylthioglycolate)dimethyltin

• CAS: 26636-01-1
• Catalog Number: ACM26636011
• Category: Organic Tin
• Molecular Weight: 555.42
• Molecular Formula: C₂₂H₄₄O₄S₂Sn
• Synonyms: 2,2'-((dimethylstannylene)bis(thio))bis-aceticacidiisooctylester;2,2'-[(dimethylstannylene)bis(thio)]bis-aceticacidiisooctylester;Aceticacid,2,2'-[(dimethylstannylene)bis(thio)]bis-,diisooctylester;advastabtm181;advastabtm181s;bis((((isooctyloxy)carbonyl)
• Density: 1,17 g/cm³

Custom Q&A

What is the molecular formula of Bis(isooctylthioglycolate)dimethyltin?

The molecular formula is C22H44O4S2Sn.

When was this compound created and last modified?

It was created on 2007-12-05 and last modified on 2023-12-30.

What are some synonyms for Bis(isooctylthioglycolate)dimethyltin?

Some synonyms include Advastab TM 181S and DIISOOCTYL 2,2'-[(DIMETHYLSTANNYLENE)BIS(THIO)]DIACETATE.

How is the InChIKey for this compound computed?

The InChIKey is computed by InChI 1.0.6.

What is the Canonical SMILES for Bis(isooctylthioglycolate)dimethyltin?

The Canonical SMILES is CC(C)CCCCCOC(=O)CS[Sn](C)(C)SCC(=O)OCCCCCC(C)C.

What is the molecular weight of Bis(isooctylthioglycolate)dimethyltin?

The molecular weight is 555.4 g/mol.

How many hydrogen bond acceptor counts does this compound have?

It has 6 hydrogen bond acceptor counts.

What is the exact mass of Bis(isooctylthioglycolate)dimethyltin?

The exact mass is 556.170305 g/mol.

What is the heavy atom count for this compound?

The heavy atom count is 29.

How many rotatable bond counts does Bis(isooctylthioglycolate)dimethyltin have?

It has 20 rotatable bond counts.