Bis(2,3-epoxypropyl)cyclohex-4-ene-1,2-dicarboxylate

• CAS: 21544-03-6
• Catalog Number: ACM21544036
• Category: Other Products
• Molecular Weight: 282.28912
• Molecular Formula: C₁₄H₁₈O₆
• Synonyms: bis(2,3-epoxypropyl) cyclohex-4-ene-1,2-dicarboxylate ;tetrahydrophthalic acid diglycidylester;1,2,3,6-Tetrahydrophthalic acid diglycidyl ester;4-Cyclohexene-1,2-dicarboxylic acid bis(oxiran-2-ylmethyl) ester;4-Cyclohexene-1,2-dicarboxylic acid diglycidyl ester;4-Cyclohexene-1,2-dicarboxylic acid bis(oxiranylmethyl) ester;Einecs 244-435-6;Bis(2,3-epoxypropyl) cyclohex-4-ene-1,2-dicarboxylate(S-182)(CY183)

Custom Q&A

What is the molecular formula of Bis(2,3-epoxypropyl)cyclohex-4-ene-1,2-dicarboxylate?

The molecular formula is C14H18O6.

When was the compound last modified?

The compound was last modified on December 30, 2023.

What are some synonyms for Bis(2,3-epoxypropyl)cyclohex-4-ene-1,2-dicarboxylate?

Some synonyms include bis(oxiran-2-ylmethyl) cyclohex-4-ene-1,2-dicarboxylate and 4-Cyclohexene-1,2-dicarboxylic acid, bis(oxiranylmethyl) ester.

What is the InChIKey of the compound?

The InChIKey is KTPIWUHKYIJBCR-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES is C1C=CCC(C1C(=O)OCC2CO2)C(=O)OCC3CO3.

What is the molecular weight of Bis(2,3-epoxypropyl)cyclohex-4-ene-1,2-dicarboxylate?

The molecular weight is 282.29 g/mol.

How many hydrogen bond acceptors does the compound have?

The compound has 6 hydrogen bond acceptors.

What is the topological polar surface area of the compound?

The topological polar surface area is 77.7 Ų.

How many rotatable bonds does Bis(2,3-epoxypropyl)cyclohex-4-ene-1,2-dicarboxylate have?

The compound has 8 rotatable bonds.

What is the formal charge of the compound?

The formal charge is 0.