Betulin 3-acetate

• CAS: 27570-20-3
• Catalog Number: ACM27570203
• Category: Steroidal Compounds
• Molecular Weight: 484.75
• Molecular Formula: C₃₂H₅₂O₃

Custom Q&A

What is the molecular formula of Betulin 3-acetate?

The molecular formula of Betulin 3-acetate is C32H52O3.

What is the molecular weight of Betulin 3-acetate?

The molecular weight of Betulin 3-acetate is 484.8 g/mol.

What is the IUPAC name of Betulin 3-acetate?

The IUPAC name of Betulin 3-acetate is [(1R,3aS,5aR,5bR,7aR,9S,11aR,11bR,13aR,13bR)-3a-(hydroxymethyl)-5a,5b,8,8,11a-pentamethyl-1-prop-1-en-2-yl-1,2,3,4,5,6,7,7a,9,10,11,11b,12,13,13a,13b-hexadecahydrocyclopenta[a]chrysen-9-yl] acetate.

What is the InChIKey of Betulin 3-acetate?

The InChIKey of Betulin 3-acetate is XUDTWJGGQFHXCR-VFUWXHBOSA-N.

What is the canonical SMILES of Betulin 3-acetate?

The canonical SMILES of Betulin 3-acetate is CC(=C)C1CCC2(C1C3CCC4C5(CCC(C(C5CCC4(C3(CC2)C)C)(C)C)OC(=O)C)C)CO.

What is the CAS number of Betulin 3-acetate?

The CAS number of Betulin 3-acetate is 27570-20-3.

How many hydrogen bond donor counts are there in Betulin 3-acetate?

There is 1 hydrogen bond donor count in Betulin 3-acetate.

How many hydrogen bond acceptor counts are there in Betulin 3-acetate?

There are 3 hydrogen bond acceptor counts in Betulin 3-acetate.

How many rotatable bond counts are there in Betulin 3-acetate?

There are 4 rotatable bond counts in Betulin 3-acetate.

What is the topological polar surface area of Betulin 3-acetate?

The topological polar surface area of Betulin 3-acetate is 46.5Ų.