Azithromycin impurity b

• CAS: 307974-61-4
• Catalog Number: ACM307974614
• Category: Other Products
• Molecular Weight: 0
• Synonyms: AZITHROMYCIN IMPURITY B;AzithroMycin B;Azithromycin EP Impurity B

Custom Q&A

What is the molecular formula of Azithromycin impurity b?

The molecular formula of Azithromycin impurity b is C38H72N2O11.

What is the molecular weight of Azithromycin impurity b?

The molecular weight of Azithromycin impurity b is 733.0 g/mol.

What is the IUPAC name of Azithromycin impurity b?

The IUPAC name of Azithromycin impurity b is (2R,3R,4S,5R,8R,10R,11R,12S,13S,14R)-11-[(2S,3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-2-ethyl-4,10-dihydroxy-13-[(2R,4R,5S,6S)-5-hydroxy-4-methoxy-4,6-dimethyloxan-2-yl]oxy-3,5,6,8,10,12,14-heptamethyl-1-oxa-6-azacyclopentadecan-15-one.

What is the InChIKey of Azithromycin impurity b?

The InChIKey of Azithromycin impurity b is JBYIGHZCRVMHAK-VINPOOLWSA-N.

What is the canonical SMILES of Azithromycin impurity b?

The canonical SMILES of Azithromycin impurity b is CCC1C(C(C(N(CC(CC(C(C(C(C(=O)O1)C)OC2CC(C(C(O2)C)O)(C)OC)C)OC3C(C(CC(O3)C)N(C)C)O)(C)O)C)C)C)O.

What is the CAS number of Azithromycin impurity b?

The CAS number of Azithromycin impurity b is 307974-61-4.

How many hydrogen bond donor counts does Azithromycin impurity b have?

Azithromycin impurity b has 4 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Azithromycin impurity b have?

Azithromycin impurity b has 13 hydrogen bond acceptor counts.

How many rotatable bond counts does Azithromycin impurity b have?

Azithromycin impurity b has 7 rotatable bond counts.

What is the topological polar surface area of Azithromycin impurity b?

The topological polar surface area of Azithromycin impurity b is 160?2.