Anolignan b

• CAS: 158081-98-2
• Catalog Number: ACM158081982
• Category: Other Products
• Molecular Weight: 266.338
• Molecular Formula: C₁₈H₁₈O₂
• Synonyms: anolignan B

Custom Q&A

What is the molecular formula of Anolignan B according to the reference?

The molecular formula of Anolignan B is C18H18O2.

What is the molecular weight of Anolignan B?

The molecular weight of Anolignan B is 266.3 g/mol.

How is Anolignan B described in terms of structure and substitution?

Anolignan B is described as a lignan that consists of buta-1,3-diene substituted by 4-hydroxybenzyl groups at positions 2 and 3.

What is the role of Anolignan B in terms of its activity?

Anolignan B exhibits anti-HIV activity by inhibiting the HIV-1 reverse transcriptase enzyme.

Where is Anolignan B isolated from?

Anolignan B is isolated from the ground stems of Anogeissus acuminata.

What are some synonyms for Anolignan B?

Some synonyms for Anolignan B include 2,3-Bis-(4-hydroxybenzyl)-1,3-butadiene and T002L6QU06.

What is the InChIKey for Anolignan B?

The InChIKey for Anolignan B is VVKZAZVVUAFFGF-UHFFFAOYSA-N.

What is the Canonical SMILES representation of Anolignan B?

The Canonical SMILES representation of Anolignan B is C=C(CC1=CC=C(C=C1)O)C(=C)CC2=CC=C(C=C2)O.

What is the XLogP3-AA value for Anolignan B?

The XLogP3-AA value for Anolignan B is 5.5.

How many hydrogen bond donor and acceptor counts does Anolignan B have?

Anolignan B has 2 hydrogen bond donor counts and 2 hydrogen bond acceptor counts.