What is the molecular formula of Alpha-hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide?
The molecular formula is C16H22BrNO3.
What is the molecular weight of Alpha-hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide?
The molecular weight is 356.25 g/mol.
What are some synonyms for Alpha-hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide?
Some synonyms include HOMATROPINE HYDROBROMIDE and homatropine bromide.
What is the IUPAC Name of Alpha-hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide?
The IUPAC Name is [(1R,5S)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2-phenylacetate; hydrobromide.
What is the Canonical SMILES of Alpha-hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide?
The Canonical SMILES is CN1C2CCC1CC(C2)OC(=O)C(C3=CC=CC=C3)O.Br.
What is the InChIKey of Alpha-hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide?
The InChIKey is DWSGTFTVBLXELC-MOTQWOLNSA-N.
What is the CAS number of Alpha-hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide?
The CAS number is 51-56-9.
How many hydrogen bond donor counts does Alpha-hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide have?
It has 2 hydrogen bond donor counts.
What is the topological polar surface area of Alpha-hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide?
The topological polar surface area is 49.8 Å2.
What is the complexity of Alpha-hydroxybenzeneacetic acid 8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester hydrobromide?
The complexity is computed by PubChem.