Alpha-[(2-pyridylamino)methyl]benzyl alcohol monohydrochloride

• CAS: 326-43-2
• Catalog Number: ACM326432
• Category: Other Products
• Molecular Weight: 250.724
• Molecular Formula: C₁₃H₁₅ClN₂O
• Synonyms: alpha-[(2-pyridylamino)methyl]benzyl alcohol monohydrochloride ;FENYRAMIDOLHYDROCHLORIDE

Custom Q&A

What is the molecular formula of Alpha-[(2-pyridylamino)methyl]benzyl alcohol monohydrochloride?

The molecular formula is C13H15ClN2O.

What is the molecular weight of Alpha-[(2-pyridylamino)methyl]benzyl alcohol monohydrochloride?

The molecular weight is 250.72 g/mol.

What is the IUPAC name of Alpha-[(2-pyridylamino)methyl]benzyl alcohol monohydrochloride?

The IUPAC name is 1-phenyl-2-(pyridin-2-ylamino)ethanol;hydrochloride.

What is the InChI of Alpha-[(2-pyridylamino)methyl]benzyl alcohol monohydrochloride?

The InChI is InChI=1S/C13H14N2O.ClH/c16-12(11-6-2-1-3-7-11)10-15-13-8-4-5-9-14-13;/h1-9,12,16H,10H2,(H,14,15);1H.

What is the InChIKey of Alpha-[(2-pyridylamino)methyl]benzyl alcohol monohydrochloride?

The InChIKey is HYYDHUILGLWOOP-UHFFFAOYSA-N.

What is the canonical SMILES of Alpha-[(2-pyridylamino)methyl]benzyl alcohol monohydrochloride?

The canonical SMILES is C1=CC=C(C=C1)C(CNC2=CC=CC=N2)O.Cl.

What is the CAS number of Alpha-[(2-pyridylamino)methyl]benzyl alcohol monohydrochloride?

The CAS number is 326-43-2.

How many hydrogen bond donor counts does Alpha-[(2-pyridylamino)methyl]benzyl alcohol monohydrochloride have?

It has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does Alpha-[(2-pyridylamino)methyl]benzyl alcohol monohydrochloride have?

It has 3 hydrogen bond acceptor counts.