What is the molecular formula of 7-Bromo-4-chlorothieno[3,2-d]pyrimidine?
The molecular formula is C6H2BrClN2S.
When was 7-Bromo-4-chlorothieno[3,2-d]pyrimidine created and modified in PubChem?
It was created on 2007-08-09 and modified on 2023-11-25.
What is the IUPAC Name of 7-Bromo-4-chlorothieno[3,2-d]pyrimidine?
The IUPAC Name is 7-bromo-4-chlorothieno[3,2-d]pyrimidine.
What is the InChIKey of 7-Bromo-4-chlorothieno[3,2-d]pyrimidine?
The InChIKey is LJFZDPZIIKOATA-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 7-Bromo-4-chlorothieno[3,2-d]pyrimidine?
The Canonical SMILES is C1=C(C2=C(S1)C(=NC=N2)Cl)Br.
What is the molecular weight of 7-Bromo-4-chlorothieno[3,2-d]pyrimidine?
The molecular weight is 249.52 g/mol.
How many hydrogen bond acceptors does 7-Bromo-4-chlorothieno[3,2-d]pyrimidine have?
It has 3 hydrogen bond acceptors.
What is the exact mass of 7-Bromo-4-chlorothieno[3,2-d]pyrimidine?
The exact mass is 247.88106 g/mol.
What is the topological polar surface area of 7-Bromo-4-chlorothieno[3,2-d]pyrimidine?
The topological polar surface area is 54Ų.
Is 7-Bromo-4-chlorothieno[3,2-d]pyrimidine classified as a canonicalized compound in PubChem?
Yes, it is classified as a canonicalized compound in PubChem.