CAS
124-48-1 Purity
---
124-48-1 Purity
---
Inquiry Basket
7-Bromo-3-methoxyquinoline
CAS
1246548-95-7
Catalog Number
ACM1246548957
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 7-Bromo-3-methoxyquinoline?
The molecular formula of 7-Bromo-3-methoxyquinoline is C10H8BrNO.
What is the molecular weight of 7-Bromo-3-methoxyquinoline?
The molecular weight of 7-Bromo-3-methoxyquinoline is 238.08 g/mol.
What is the IUPAC name of 7-Bromo-3-methoxyquinoline?
The IUPAC name of 7-Bromo-3-methoxyquinoline is 7-bromo-3-methoxyquinoline.
What is the InChI of 7-Bromo-3-methoxyquinoline?
The InChI of 7-Bromo-3-methoxyquinoline is InChI=1S/C10H8BrNO/c1-13-9-4-7-2-3-8(11)5-10(7)12-6-9/h2-6H,1H3.
What is the InChIKey of 7-Bromo-3-methoxyquinoline?
The InChIKey of 7-Bromo-3-methoxyquinoline is UOSVBHOMCFHOSP-UHFFFAOYSA-N.
What is the canonical SMILES of 7-Bromo-3-methoxyquinoline?
The canonical SMILES of 7-Bromo-3-methoxyquinoline is COC1=CN=C2C=C(C=CC2=C1)Br.
What is the CAS number of 7-Bromo-3-methoxyquinoline?
The CAS number of 7-Bromo-3-methoxyquinoline is 1246548-95-7.
What is the XLogP3-AA value of 7-Bromo-3-methoxyquinoline?
The XLogP3-AA value of 7-Bromo-3-methoxyquinoline is 2.9.
How many hydrogen bond donor counts does 7-Bromo-3-methoxyquinoline have?
7-Bromo-3-methoxyquinoline has 0 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 7-Bromo-3-methoxyquinoline have?
7-Bromo-3-methoxyquinoline has 2 hydrogen bond acceptor counts.
Recommended Products
![6-Bromo-3-iodoimidazo[1,2-a]pyrazine](https://resource.alfa-chemistry.com/structure/1245644-42-1.gif)
![7-Bromo-1H-pyrazolo[4,3-b]pyridine](https://resource.alfa-chemistry.com/structure/1256806-33-3.gif)
