7-Aminonaphthalene-1,3-disulfonic acid

CAS

86‑65‑7

Catalog Number

ACM86657

Category

Main Products

Molecular Weight

303.31

Molecular Formula

C₁₀H₉NO₆S₂

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

7-amino-3-naphthalenedisulfonicacid;AMINO K ACID;K-ACID;7-aminonaphthalene-1,3-disulphonic acid;2-NAPHTHYLAMINE-6,8-DISULFONIC ACID (AMINO G SALT);7-aminonaphthalene-1,3-disulfonic acid;1,3-Disulfo-7-naphthylamine;7-Amino-1,3-naphthalenedisulfonic acid,

Physical Description

7-Amino-1,3-naphthalenedisulfonic acid tech. (500g)

What is the molecular formula of 7-Aminonaphthalene-1,3-disulfonic acid?

The molecular formula of 7-Aminonaphthalene-1,3-disulfonic acid is C10H9NO6S2.

What are the synonyms of 7-Aminonaphthalene-1,3-disulfonic acid?

The synonyms of 7-Aminonaphthalene-1,3-disulfonic acid are 86-65-7, 7-aminonaphthalene-1,3-disulfonic acid, 7-Amino-1,3-naphthalenedisulfonic acid, Amido-G-acid, and Amino-G-Acid.

What is the molecular weight of 7-Aminonaphthalene-1,3-disulfonic acid?

The molecular weight of 7-Aminonaphthalene-1,3-disulfonic acid is 303.3 g/mol.

What is the IUPAC name of 7-Aminonaphthalene-1,3-disulfonic acid?

The IUPAC name of 7-Aminonaphthalene-1,3-disulfonic acid is 7-aminonaphthalene-1,3-disulfonic acid.

What is the InChI of 7-Aminonaphthalene-1,3-disulfonic acid?

The InChI of 7-Aminonaphthalene-1,3-disulfonic acid is InChI=1S/C10H9NO6S2/c11-7-2-1-6-3-8(18(12,13)14)5-10(9(6)4-7)19(15,16)17/h1-5H,11H2,(H,12,13,14)(H,15,16,17).

What is the InChIKey of 7-Aminonaphthalene-1,3-disulfonic acid?

The InChIKey of 7-Aminonaphthalene-1,3-disulfonic acid is CMOLPZZVECHXKN-UHFFFAOYSA-N.

What is the canonical SMILES of 7-Aminonaphthalene-1,3-disulfonic acid?

The canonical SMILES of 7-Aminonaphthalene-1,3-disulfonic acid is C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)O)S(=O)(=O)O)N.

What is the CAS number of 7-Aminonaphthalene-1,3-disulfonic acid?

The CAS number of 7-Aminonaphthalene-1,3-disulfonic acid is 86-65-7.

What is the physical description of 7-Aminonaphthalene-1,3-disulfonic acid?

7-Aminonaphthalene-1,3-disulfonic acid is described as fine needles that are soluble in water.

What is the hydrogen bond donor count of 7-Aminonaphthalene-1,3-disulfonic acid?

The hydrogen bond donor count of 7-Aminonaphthalene-1,3-disulfonic acid is 3.