7,8-Diaminopelargonic acid

• CAS: 21738-21-6
• Catalog Number: ACM21738216
• Category: Other Products
• Molecular Weight: 188.2673
• Molecular Formula: C₉H₂₀N₂O₂
• Synonyms: 7,8-DIAMINOPELARGONIC ACID;7,8-Diamino-nonanoic Acid;7,8-Diaminopelargonsaeure

Custom Q&A

What is the molecular formula of 7,8-diaminopelargonic acid?

The molecular formula of 7,8-diaminopelargonic acid is C9H20N2O2.

What is the molecular weight of 7,8-diaminopelargonic acid?

The molecular weight of 7,8-diaminopelargonic acid is 188.27 g/mol.

What are the synonyms for 7,8-diaminopelargonic acid?

The synonyms for 7,8-diaminopelargonic acid include 7,8-diaminononanoic acid, 21738-21-6, and DAPA.

Is 7,8-diaminopelargonic acid a naturally occurring compound?

Yes, some isomers of 7,8-diaminopelargonic acid are naturally occurring intermediates of biotin synthesis.

What is the IUPAC name of 7,8-diaminopelargonic acid?

The IUPAC name of 7,8-diaminopelargonic acid is 7,8-diaminononanoic acid.

What is the InChI of 7,8-diaminopelargonic acid?

The InChI of 7,8-diaminopelargonic acid is InChI=1S/C9H20N2O2/c1-7(10)8(11)5-3-2-4-6-9(12)13/h7-8H,2-6,10-11H2,1H3,(H,12,13).

What is the InChIKey of 7,8-diaminopelargonic acid?

The InChIKey of 7,8-diaminopelargonic acid is KCEGBPIYGIWCDH-UHFFFAOYSA-N.

How many hydrogen bond donor counts does 7,8-diaminopelargonic acid have?

7,8-diaminopelargonic acid has 3 hydrogen bond donor counts.

How many rotatable bond counts does 7,8-diaminopelargonic acid have?

7,8-diaminopelargonic acid has 7 rotatable bond counts.

What is the topological polar surface area of 7,8-diaminopelargonic acid?

The topological polar surface area of 7,8-diaminopelargonic acid is 89.3 ?2.