CAS
957198-31-1 Purity
---
957198-31-1 Purity
---
Inquiry Basket
6-(Tetrahydro-furan-3-yloxy)pyridine-2-boronicacidpinacolester
CAS
1315351-11-1
Catalog Number
ACM1315351111
Category
Boronic Esters
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C15H22BNO4.
What is the synonym for the compound?
One of the synonyms for the compound is 6-(Tetrahydro-furan-3-yloxy)pyridine-2-boronic acid pinacol ester.
What is the molecular weight of the compound?
The molecular weight of the compound is 291.15 g/mol.
When was the compound created?
The compound was created on June 21, 2010.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 2-(oxolan-3-yloxy)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
What is the InChI key of the compound?
The InChI key of the compound is AAKBXCOMANMIML-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B1(OC(C(O1)(C)C)(C)C)C2=NC(=CC=C2)OC3CCOC3.
How many hydrogen bond donor counts does the compound have?
The compound has 0 hydrogen bond donor counts.
How many rotatable bond counts does the compound have?
The compound has 3 rotatable bond counts.
Is the compound canonicalized?
Yes, the compound is canonicalized according to PubChem.
Recommended Products
CAS
1310405-03-8 Purity
---
1310405-03-8 Purity
---
CAS
1310405-07-2 Purity
---
1310405-07-2 Purity
---
