6-Methoxy-1-oxo-1,2,3,4-tetrahydro-[2]-naphthaldehyde

• Catalog Number: ACMA00002295
• Category: Ethers
• Molecular Weight: 204.22
• Molecular Formula: C₁₂H₁₂N₂O₂
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 6-Methoxy-1-oxo-1,2,3,4-tetrahydro-[2]-naphthaldehyde?

The molecular formula is C12H12O3.

What is the IUPAC name of 6-Methoxy-1-oxo-1,2,3,4-tetrahydro-[2]-naphthaldehyde?

The IUPAC name is 6-methoxy-1-oxo-3,4-dihydro-2H-naphthalene-2-carbaldehyde.

What is the InChI of 6-Methoxy-1-oxo-1,2,3,4-tetrahydro-[2]-naphthaldehyde?

The InChI is InChI=1S/C12H12O3/c1-15-10-4-5-11-8(6-10)2-3-9(7-13)12(11)14/h4-7,9H,2-3H2,1H3.

What is the InChIKey of 6-Methoxy-1-oxo-1,2,3,4-tetrahydro-[2]-naphthaldehyde?

The InChIKey is NTVKOYKLIKUWHM-UHFFFAOYSA-N.

What is the canonical SMILES of 6-Methoxy-1-oxo-1,2,3,4-tetrahydro-[2]-naphthaldehyde?

The canonical SMILES is COC1=CC2=C(C=C1)C(=O)C(CC2)C=O.

What is the molecular weight of 6-Methoxy-1-oxo-1,2,3,4-tetrahydro-[2]-naphthaldehyde?

The molecular weight is 204.22 g/mol.

What is the CAS number of 6-Methoxy-1-oxo-1,2,3,4-tetrahydro-[2]-naphthaldehyde?

The CAS number is 68950-67-4.

What is the XLogP3-AA value of 6-Methoxy-1-oxo-1,2,3,4-tetrahydro-[2]-naphthaldehyde?

The XLogP3-AA value is 1.7.

How many hydrogen bond donor counts does 6-Methoxy-1-oxo-1,2,3,4-tetrahydro-[2]-naphthaldehyde have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 6-Methoxy-1-oxo-1,2,3,4-tetrahydro-[2]-naphthaldehyde have?

It has 3 hydrogen bond acceptor counts.