What is the molecular formula of 6-chloro-2-Methyl-3-bromo-imidazo[1,2-b]pyridazine?
The molecular formula is C7H6Br2ClN3.
When was 6-chloro-2-Methyl-3-bromo-imidazo[1,2-b]pyridazine created and modified?
It was created on 2011-12-30 and modified on 2023-12-30.
What is the IUPAC name of 6-chloro-2-Methyl-3-bromo-imidazo[1,2-b]pyridazine?
The IUPAC name is 1,3-dibromo-6-chloro-2-methyl-5H-imidazo[1,2-b]pyridazine.
What is the InChIKey of 6-chloro-2-Methyl-3-bromo-imidazo[1,2-b]pyridazine?
The InChIKey is AKBXLEGARWENOM-UHFFFAOYSA-N.
What is the Canonical SMILES of 6-chloro-2-Methyl-3-bromo-imidazo[1,2-b]pyridazine?
The Canonical SMILES is CC1=C(N2C(=CC=C(N2)Cl)N1Br)Br.
What is the molecular weight of 6-chloro-2-Methyl-3-bromo-imidazo[1,2-b]pyridazine?
The molecular weight is 327.40 g/mol.
How many hydrogen bond donor counts are there in 6-chloro-2-Methyl-3-bromo-imidazo[1,2-b]pyridazine?
There is 1 hydrogen bond donor count.
What is the topological polar surface area of 6-chloro-2-Methyl-3-bromo-imidazo[1,2-b]pyridazine?
The topological polar surface area is 18.5Ų.
Is the compound canonicalized?
Yes, the compound is canonicalized.
What is the XLogP3-AA value for 6-chloro-2-Methyl-3-bromo-imidazo[1,2-b]pyridazine?
The XLogP3-AA value is 4.7.