6-Chloro-1H-pyrazolo[3,4-b]pyrazine

• CAS: 1260664-81-0
• Catalog Number: ACM1260664810
• Category: Pyrazines
• Molecular Weight: 154.6
• Molecular Formula: C5H3ClN4
• Appearance: Yellow powder

Custom Q&A

What is the molecular formula of 6-Chloro-1H-pyrazolo[3,4-b]pyrazine?

The molecular formula is C5H3ClN4.

What is the molecular weight of 6-Chloro-1H-pyrazolo[3,4-b]pyrazine?

The molecular weight is 154.56 g/mol.

What is the IUPAC name of 6-Chloro-1H-pyrazolo[3,4-b]pyrazine?

The IUPAC name is 6-chloro-1H-pyrazolo[3,4-b]pyrazine.

What is the InChI of 6-Chloro-1H-pyrazolo[3,4-b]pyrazine?

The InChI is InChI=1S/C5H3ClN4/c6-4-2-7-3-1-8-10-5(3)9-4/h1-2H,(H,8,9,10).

What is the InChIKey of 6-Chloro-1H-pyrazolo[3,4-b]pyrazine?

The InChIKey is PGTUKZWBYWVLHW-UHFFFAOYSA-N.

What is the Canonical SMILES of 6-Chloro-1H-pyrazolo[3,4-b]pyrazine?

The Canonical SMILES is C1=C(N=C2C(=N1)C=NN2)Cl.

What is the CAS number of 6-Chloro-1H-pyrazolo[3,4-b]pyrazine?

The CAS number is 1260664-81-0.

What is the XLogP3-AA value of 6-Chloro-1H-pyrazolo[3,4-b]pyrazine?

The XLogP3-AA value is 0.8.

What is the hydrogen bond donor count of 6-Chloro-1H-pyrazolo[3,4-b]pyrazine?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of 6-Chloro-1H-pyrazolo[3,4-b]pyrazine?

The hydrogen bond acceptor count is 3.