What is the molecular formula of 6-Bromo-3,4-dihydro-4-oxothieno[2,3-d]pyrimidine?
The molecular formula is C6H3BrN2OS.
What is the molecular weight of 6-Bromo-3,4-dihydro-4-oxothieno[2,3-d]pyrimidine?
The molecular weight is 231.07 g/mol.
What is the IUPAC name of 6-Bromo-3,4-dihydro-4-oxothieno[2,3-d]pyrimidine?
The IUPAC name is 6-bromo-3H-thieno[2,3-d]pyrimidin-4-one.
What is the InChI of 6-Bromo-3,4-dihydro-4-oxothieno[2,3-d]pyrimidine?
The InChI is InChI=1S/C6H3BrN2OS/c7-4-1-3-5(10)8-2-9-6(3)11-4/h1-2H,(H,8,9,10).
What is the InChIKey of 6-Bromo-3,4-dihydro-4-oxothieno[2,3-d]pyrimidine?
The InChIKey is WIURMUHBQYODCB-UHFFFAOYSA-N.
What is the canonical SMILES of 6-Bromo-3,4-dihydro-4-oxothieno[2,3-d]pyrimidine?
The canonical SMILES is C1=C(SC2=C1C(=O)NC=N2)Br.
What is the CAS number of 6-Bromo-3,4-dihydro-4-oxothieno[2,3-d]pyrimidine?
The CAS number is 56844-40-7.
What is the XLogP3-AA value of 6-Bromo-3,4-dihydro-4-oxothieno[2,3-d]pyrimidine?
The XLogP3-AA value is 1.7.
Does 6-Bromo-3,4-dihydro-4-oxothieno[2,3-d]pyrimidine have any defined atom stereocenter count?
No, 6-Bromo-3,4-dihydro-4-oxothieno[2,3-d]pyrimidine does not have any defined atom stereocenter count.