6-Bromo-2-pyridinecarboxylic acid

• CAS: 21190-87-4
• Catalog Number: ACM21190874
• Category: Bromine Series

Custom Q&A

What is the molecular formula of 6-Bromo-2-pyridinecarboxylic acid?

The molecular formula is C6H4BrNO2.

What is the synonym for 6-Bromo-2-pyridinecarboxylic acid?

The synonym is 6-Bromopicolinic acid.

What is the molecular weight of 6-Bromo-2-pyridinecarboxylic acid?

The molecular weight is 202.01 g/mol.

What is the IUPAC name of 6-Bromo-2-pyridinecarboxylic acid?

The IUPAC name is 6-bromopyridine-2-carboxylic acid.

What is the InChI of 6-Bromo-2-pyridinecarboxylic acid?

The InChI is InChI=1S/C6H4BrNO2/c7-5-3-1-2-4(8-5)6(9)10/h1-3H,(H,9,10).

What is the InChIKey of 6-Bromo-2-pyridinecarboxylic acid?

The InChIKey is XURXQNUIGWHWHU-UHFFFAOYSA-N.

What is the canonical SMILES of 6-Bromo-2-pyridinecarboxylic acid?

The canonical SMILES is C1=CC(=NC(=C1)Br)C(=O)O.

What is the CAS number of 6-Bromo-2-pyridinecarboxylic acid?

The CAS number is 21190-87-4.

What is the XLogP3-AA value of 6-Bromo-2-pyridinecarboxylic acid?

The XLogP3-AA value is 1.7.

Is 6-Bromo-2-pyridinecarboxylic acid a canonicalized compound?

Yes, 6-Bromo-2-pyridinecarboxylic acid is a canonicalized compound.