6-Bromo-2-(5-methyl-furan-2-yl)quinoline-4-carboxylic acid

• CAS: 350998-12-8
• Catalog Number: ACM350998128
• Category: Bromine Series
• Molecular Weight: 332.15
• Molecular Formula: C₁₅H₁₀BrNO₃
• Synonyms: 6-BROMO-2-(5-METHYL-FURAN-2-YL)-QUINOLINE-4-CARBOXYLIC ACID

Custom Q&A

What is the molecular formula of the compound with PubChem CID 753116?

The molecular formula is C15H10BrNO3.

When was the compound created according to PubChem?

The compound was created on July 8, 2005.

What is the InChIKey for this compound?

The InChIKey is PJDQCOBHWQSBSN-UHFFFAOYSA-N.

What is the Canonical SMILES representation of this compound?

The Canonical SMILES representation is CC1=CC=C(O1)C2=NC3=C(C=C(C=C3)Br)C(=C2)C(=O)O.

What is the molecular weight of the compound?

The molecular weight is 332.15 g/mol.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 4 hydrogen bond acceptor counts.

What is the exact mass of the compound?

The exact mass is 330.98441 g/mol.

What is the topological polar surface area of the compound?

The topological polar surface area is 63.3Ų.

Is the compound canonicalized according to PubChem?

Yes, the compound is canonicalized.